For research use only. Not for therapeutic Use.
1-Naphthyl 3,5-dinitrobenzoate(Cat No.:R060969)is an organic compound consisting of a naphthyl group attached to a 3,5-dinitrobenzoate moiety. This compound is typically used in chemical synthesis, where its structural properties make it a useful intermediate for the development of other organic materials and pharmaceuticals. The presence of both a naphthalene ring and nitro groups can lend the molecule with distinct electronic characteristics, which may have applications in materials science, particularly in the development of light-sensitive or electron-accepting compounds. Research may explore its potential in drug design and other specialized chemical applications.
CAS Number | 93261-39-3 |
Synonyms | naphthalen-1-yl 3,5-dinitrobenzoate |
Molecular Formula | C17H10N2O6 |
Purity | ≥95% |
IUPAC Name | naphthalen-1-yl 3,5-dinitrobenzoate |
InChI | InChI=1S/C17H10N2O6/c20-17(12-8-13(18(21)22)10-14(9-12)19(23)24)25-16-7-3-5-11-4-1-2-6-15(11)16/h1-10H |
InChIKey | WYKPSINHJUWDHK-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=CC=C2OC(=O)C3=CC(=CC(=C3)[N+](=O)[O-])[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |