For research use only. Not for therapeutic Use.
1-Naphthylamine-d7 is a deuterium-labeled version of 1-naphthylamine, an aromatic amine used primarily in chemical and pharmaceutical research. The deuterium atoms replace hydrogen atoms, making it useful in studies involving mass spectrometry and nuclear magnetic resonance (NMR) for tracking and analyzing metabolic processes. This compound is significant in investigating the metabolic fate and interactions of aromatic amines. It also plays a role in the synthesis of dyes, pigments, and as an intermediate in the production of various organic compounds, aiding in the development of new materials and drugs.
CAS Number | 78832-53-8 |
Synonyms | 1-Aminonaphthalene-d7; Fast Garnet Base B-d7; Naphthalen-1-ylamine-d7; Naphthalidam-d7; Naphthalidine-d7; α-Naphthylamine-d7; 1-Napthalen-2,3,4,5,6,7,8-d7-amine; |
Molecular Formula | C10H9N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N,N,2,3,4,5,6-heptadeuterionaphthalen-1-amine |
InChI | InChI=1S/C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,11H2/i1D,2D,3D,4D,5D,6D,7D |
InChIKey | RUFPHBVGCFYCNW-GSNKEKJESA-N |
SMILES | [2H]C1=CC=C2C(=C1[2H])C(=C(C(=C2N([2H])[2H])[2H])[2H])[2H] |