For research use only. Not for therapeutic Use.
1-O-[β-D-Lactosyl]-N-octadecanoyl-DL-dihydrosphingosine is a glycosphingolipid characterized by its complex structure, which includes a lactosyl sugar moiety and an octadecanoyl fatty acid chain. This compound plays a significant role in cell membrane biology and lipid signaling. Its unique properties contribute to various biological functions, including cell recognition and signaling pathways. Research is ongoing into its potential therapeutic applications, particularly in cancer and metabolic diseases, highlighting the importance of glycosphingolipids in health and disease.
CAS Number | 15373-20-3 |
Molecular Formula | C48H93NO13 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-[1-[3,4-dihydroxy-6-(hydroxymethyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxyoctadecan-2-yl]octadecanamide |
InChI | InChI=1S/C48H93NO13/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-40(53)49-36(37(52)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2)35-59-47-45(58)43(56)46(39(34-51)61-47)62-48-44(57)42(55)41(54)38(33-50)60-48/h36-39,41-48,50-52,54-58H,3-35H2,1-2H3,(H,49,53) |
InChIKey | PZGGVRFULLAFKR-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCCC(=O)NC(COC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O)C(CCCCCCCCCCCCCCC)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |