For research use only. Not for therapeutic Use.
1-O-Hexadecyl-rac-glycerol, also known as chimyl alcohol, is a glycerol ether lipid commonly used in biochemical research and pharmaceutical applications. This compound, characterized by a long alkyl chain attached to a glycerol backbone, is notable for its role as a precursor in the biosynthesis of ether lipids and plasmalogens, which are essential components of cell membranes. It has been studied for its potential in modulating immune responses and enhancing the efficacy of certain cancer treatments. Its structural properties make it valuable for investigating lipid metabolism, membrane biology, and signaling pathways in various biological systems.
CAS Number | 6145-69-3 |
Synonyms | (±)-3-(Hexadecyloxy)-1,2-propanediol; (±)-1-Hexadecyl glycerol; 1-Hexadecylglycerol; ?1-O-Hexadecylglycerol; 3-Hexadecyloxypropane-1,2-diol; Glyceryl-1-hexadecyl ether; NSC 59269; rac-1-O-Hexadecylglycerol |
Molecular Formula | C19H40O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-hexadecoxypropane-1,2-diol |
InChI | InChI=1S/C19H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-18-19(21)17-20/h19-21H,2-18H2,1H3 |
InChIKey | OOWQBDFWEXAXPB-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCOCC(CO)O |