For research use only. Not for therapeutic Use.
1-(Oxan-4-yl)propan-1-one is an organic compound featuring an oxane (tetrahydropyran) ring attached to a propanone (ketone) group at the 1-position. This structure combines the stability of the oxane ring with the reactivity of the ketone, making it valuable as a building block in organic synthesis. Commonly used in pharmaceutical and chemical research, it serves as a versatile intermediate in synthesizing more complex molecules. Its unique structure also makes it useful for studying ring-containing ketones in various chemical reactions.
CAS Number | 7464-18-8 |
Molecular Formula | C8H14O2 |
Purity | ≥95% |
IUPAC Name | 1-(oxan-4-yl)propan-1-one |
InChI | InChI=1S/C8H14O2/c1-2-8(9)7-3-5-10-6-4-7/h7H,2-6H2,1H3 |
InChIKey | JTOHKFHWPJJISH-UHFFFAOYSA-N |
SMILES | CCC(=O)C1CCOCC1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |