For research use only. Not for therapeutic Use.
1-Pentanol-d11 is a fully deuterated form of 1-pentanol, where all eleven hydrogen atoms are replaced with deuterium. This isotopically labeled compound is used in various fields of research, including organic chemistry, environmental science, and metabolic studies. The deuterium atoms provide a distinct mass difference, allowing for precise tracking and analysis in mass spectrometry and NMR spectroscopy. 1-Pentanol-d11 is particularly valuable in studying reaction mechanisms, solvent effects, and the behavior of alcohols in biological systems. Researchers utilize this compound to investigate the pathways of alcohol metabolism, solvent interactions in chemical reactions, and other related processes, contributing to advancements in chemical research and the understanding of alcohol-related biochemical mechanisms.
CAS Number | 126840-22-0 |
Synonyms | 1-Pentan-1,1,2,2,3,3,4,4,5,5,5-d11-ol; Pentyl Alcohol-d11; 1-Pentyl Alcohol-d11; Amyl Alcohol-d11; Amylol-d11; Butyl Carbinol-d11; NSC 5707-d11; Pentanol-d11; n-Amyl Alcohol-d11; n-Butyl Carbinol-d11; n-Pentan-1-ol-d11; n-Pentanol-d11; n-Pentyl Alcoh |
Molecular Formula | C5H12O |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentan-1-ol |
InChI | InChI=1S/C5H12O/c1-2-3-4-5-6/h6H,2-5H2,1H3/i1D3,2D2,3D2,4D2,5D2 |
InChIKey | AMQJEAYHLZJPGS-GILSBCIXSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |