For research use only. Not for therapeutic Use.
1-Phenazinecarboxylic acid（Cat No.:R052503）is a specialized compound used in pharmaceutical research, microbiology, and organic synthesis. Featuring a phenazine ring with a carboxylic acid group, this compound is notable for its biological activity, including antimicrobial and anticancer properties. It serves as a key intermediate in the synthesis of various bioactive molecules and is particularly valuable in the development of new antibiotics and therapeutic agents. High purity and consistent quality make it essential for research in medicinal chemistry, supporting the discovery of innovative treatments and advanced chemical applications.
| Catalog Number | R052503 |
| CAS Number | 2538-68-3 |
| Synonyms | Phenazinecarboxylic Acid; NSC 15851; Phenazine-α-carboxylic Acid; Shenqinmycin; Tubermycin B; |
| Molecular Formula | C13H8N2O2 |
| Purity | ≥95% |
| Target | Fungal |
| IUPAC Name | phenazine-1-carboxylic acid |
| InChI | InChI=1S/C13H8N2O2/c16-13(17)8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7H,(H,16,17) |
| InChIKey | JGCSKOVQDXEQHI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3C=CC=C(C3=N2)C(=O)O |
