For research use only. Not for therapeutic Use.
1-Phenyl-1-butanol(Cat No.:L007143), is a chemical compound with the molecular formula C10H14O. It is an aromatic alcohol, featuring a phenyl ring attached to a four-carbon butanol chain. This compound is utilized in various industries, including perfumery and flavoring, due to its pleasant odor. Additionally, it serves as a chiral building block in organic synthesis, playing a crucial role in the production of pharmaceuticals and other specialty chemicals. Researchers often employ 1-Phenyl-1-butanol in asymmetric synthesis, where the stereochemistry of the molecule is essential, contributing to advancements in drug discovery and the development of asymmetric catalysis methodologies.
CAS Number | 614-14-2 |
Molecular Formula | C10H14O |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 1-phenylbutan-1-ol |
InChI | InChI=1S/C10H14O/c1-2-6-10(11)9-7-4-3-5-8-9/h3-5,7-8,10-11H,2,6H2,1H3 |
InChIKey | HQRWWHIETAKIMO-UHFFFAOYSA-N |
SMILES | CCCC(C1=CC=CC=C1)O |