For research use only. Not for therapeutic Use.
1-Phenyl-1H-indole-3-carbaldehyde(CAT: L042352) is a high-purity heterocyclic compound featuring a phenyl-substituted indole core with an aldehyde functional group at the 3-position. This versatile molecule is widely utilized in pharmaceutical and chemical research as a key intermediate for synthesizing complex organic compounds and bioactive molecules. Its unique structure and reactivity make it valuable for medicinal chemistry applications, particularly in the development of novel therapeutic agents and small-molecule inhibitors. With reliable quality and excellent stability, 1-Phenyl-1H-indole-3-carbaldehyde supports advanced research in drug discovery, organic synthesis, and material science.
CAS Number | 32542-59-9 |
Molecular Formula | C15H11NO |
Purity | ≥95% |
IUPAC Name | 1-phenylindole-3-carbaldehyde |
InChI | InChI=1S/C15H11NO/c17-11-12-10-16(13-6-2-1-3-7-13)15-9-5-4-8-14(12)15/h1-11H |
InChIKey | KCAGQLHYSPGZNH-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)N2C=C(C3=CC=CC=C32)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |