For research use only. Not for therapeutic Use.
1-Phenyl-1H-pyrazole-3-carbaldehyde is a heterocyclic aromatic compound featuring a phenyl-substituted pyrazole ring with an aldehyde group at the 3-position. Commonly used in pharmaceutical and organic synthesis, it serves as a versatile intermediate for developing bioactive molecules, particularly those targeting neurological and inflammatory pathways. Its reactive aldehyde group allows for various modifications, making it useful in the design of enzyme inhibitors, receptor ligands, and complex organic compounds. This compound’s stability and reactivity support applications in medicinal chemistry.
| Catalog Number | L038731 |
| CAS Number | 40261-59-4 |
| Molecular Formula | C10H8N2O |
| Purity | ≥95% |
| IUPAC Name | 1-phenylpyrazole-3-carbaldehyde |
| InChI | InChI=1S/C10H8N2O/c13-8-9-6-7-12(11-9)10-4-2-1-3-5-10/h1-8H |
| InChIKey | FDKVVJDPHDRHQS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=CC(=N2)C= |
