For research use only. Not for therapeutic Use.
1-phenyl-1H-pyrazole-3-carboxamide(Cat No.:L007318), is a chemical compound of interest due to its potential applications in medicinal chemistry and drug discovery. Pyrazole derivatives have exhibited a wide range of biological activities, including anti-inflammatory, anticancer, and antimicrobial properties. The presence of the phenyl group in this compound’s structure suggests it might have specific receptor interactions or enzyme inhibitory effects. Researchers explore such compounds to design new drugs or probe biological pathways. This compound represents a part of ongoing efforts to develop novel pharmaceutical agents with diverse therapeutic applications.
CAS Number | 1152979-17-3 |
Molecular Formula | C10H9N3O |
Purity | ≥95% |
IUPAC Name | 1-phenylpyrazole-3-carboxamide |
InChI | InChI=1S/C10H9N3O/c11-10(14)9-6-7-13(12-9)8-4-2-1-3-5-8/h1-7H,(H2,11,14) |
InChIKey | NNHQFKJWBLHANC-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)N2C=CC(=N2)C(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |