For research use only. Not for therapeutic Use.
1-Phenyl-3,4-dihydroisoquinoline is an organic compound featuring a bicyclic structure that includes a phenyl group and a dihydroisoquinoline moiety. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including analgesic and neuroprotective effects. Its unique structure allows for diverse chemical modifications, which can lead to the development of new therapeutic agents. Research focuses on exploring its biological activities and synthesis routes, making it a valuable candidate in drug discovery and the development of novel pharmaceuticals.
CAS Number | 52250-50-7 |
Molecular Formula | C15H13N |
Purity | ≥95% |
IUPAC Name | 1-phenyl-3,4-dihydroisoquinoline |
InChI | InChI=1S/C15H13N/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15/h1-9H,10-11H2 |
InChIKey | CTOQBSUYGFNMJX-UHFFFAOYSA-N |
SMILES | C1CN=C(C2=CC=CC=C21)C3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |