For research use only. Not for therapeutic Use.
1-Phenyl-imidazolidin-2-one is a heterocyclic compound commonly used in pharmaceutical research and organic synthesis. Its structure, featuring an imidazolidinone ring with a phenyl substituent, provides stability and reactivity, making it a valuable intermediate for synthesizing bioactive compounds. This compound is often used in the development of drugs, particularly as a scaffold in medicinal chemistry for exploring therapeutic applications. It supports the creation of molecules with diverse biological activities, aiding in drug discovery and the synthesis of specialized chemical frameworks.
CAS Number | 1848-69-7 |
Molecular Formula | C9H10N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-phenylimidazolidin-2-one |
InChI | InChI=1S/C9H10N2O/c12-9-10-6-7-11(9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,12) |
InChIKey | QKKGTRSHKSWYAK-UHFFFAOYSA-N |
SMILES | C1CN(C(=O)N1)C2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |