For research use only. Not for therapeutic Use.
1-Phenylbiguanide hydrochloride (Cat No.:I010342) is a chemical compound belonging to the class of biguanides. It is also referred to as phenethylbiguanide hydrochloride or PPGH. This compound is commonly used in scientific research to explore its pharmacological properties and effects on biological systems. Its potential applications span various fields, including cardiovascular research, neurobiology, and metabolism studies.
| Catalog Number | I010342 |
| CAS Number | 55-57-2 |
| Molecular Formula | C8H12ClN5 |
| Purity | ≥95% |
| Target | 5-HT Receptor |
| Solubility | Soluble to 25 mM in DMSO |
| Storage | 2-8°C |
| IUPAC Name | 1-(diaminomethylidene)-2-phenylguanidine;hydrochloride |
| InChI | InChI=1S/C8H11N5.ClH/c9-7(10)13-8(11)12-6-4-2-1-3-5-6;/h1-5H,(H6,9,10,11,12,13);1H |
| InChIKey | FHUDRDSKZQDCBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=C(N)N=C(N)N.Cl |
