Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 1-Phenylpiperidine-2-carboxylic acid
For research use only. Not for therapeutic Use.
1-Phenylpiperidine-2-carboxylic acid (Cat.No:L032764) is a chemical compound used in the synthesis of pharmaceutical intermediates. Its piperidine ring and carboxylic acid functional group make it a versatile building block in organic chemistry. This compound contributes to the creation of various molecules with potential applications in drug discovery and development.
CAS Number | 743422-75-5 |
Molecular Formula | C12H15NO2 |
Purity | ≥95% |
IUPAC Name | 1-phenylpiperidine-2-carboxylic acid |
InChI | InChI=1S/C12H15NO2/c14-12(15)11-8-4-5-9-13(11)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2,(H,14,15) |
InChIKey | MNJZHPAZVGUHNU-UHFFFAOYSA-N |