For research use only. Not for therapeutic Use.
1-Phenylpiperidine-4-carboxylic acid is a piperidine derivative featuring a phenyl group and a carboxylic acid moiety. This compound is significant in medicinal chemistry, often serving as a building block in the synthesis of pharmaceuticals and bioactive molecules. The carboxylic acid functionality enhances its reactivity and solubility, making it suitable for various chemical transformations. Its structure allows for further functionalization, contributing to the development of compounds with potential therapeutic applications, including analgesics and treatments for neurological disorders.
CAS Number | 94201-40-8 |
Molecular Formula | C12H15NO2 |
Purity | ≥95% |
IUPAC Name | 1-phenylpiperidine-4-carboxylic acid |
InChI | InChI=1S/C12H15NO2/c14-12(15)10-6-8-13(9-7-10)11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H,14,15) |
InChIKey | IXLCEJNZWAYHPL-UHFFFAOYSA-N |
SMILES | C1CN(CCC1C(=O)O)C2=CC=CC=C2 |