For research use only. Not for therapeutic Use.
1-Phenylsemicarbazide (Cat No.:M071378) is an organic compound. It is a semicarbazide derivative containing a phenyl group. This compound serves as a versatile reagent in organic synthesis, allowing the preparation of various compounds, including pharmaceuticals and agrochemicals. Its applications extend to the synthesis of semicarbazones and other derivatives used in medicinal chemistry and other industries. Furthermore, 1-Phenylsemicarbazide finds use in analytical chemistry for detecting and identifying carbonyl compounds. Its broad range of uses makes it valuable in research and industrial applications in the field of organic chemistry.
CAS Number | 103-03-7 |
Molecular Formula | C7H9N3O |
Purity | ≥95% |
Target | Fungal |
Storage | RT |
IUPAC Name | anilinourea |
InChI | InChI=1S/C7H9N3O/c8-7(11)10-9-6-4-2-1-3-5-6/h1-5,9H,(H3,8,10,11) |
InChIKey | AVKHCKXGKPAGEI-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)NNC(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |