Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors>
>
1-(Piperidin-1-yl)octadecan-1-one
For research use only. Not for therapeutic Use.
1-(Piperidin-1-yl)octadecan-1-one (CAT: L006051) is a synthetic compound that may have potential applications in organic synthesis and chemical research. Its mode of action could involve interactions with other molecules, potentially participating in various chemical reactions. While specific uses can vary, compounds like this are often investigated for their potential roles as building blocks or intermediates in the synthesis of more complex compounds.
Catalog Number | L006051 |
CAS Number | 4629-04-3 |
Molecular Formula | C23H45NO |
Purity | ≥95% |
IUPAC Name | 1-piperidin-1-yloctadecan-1-one |
InChI | InChI=1S/C23H45NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-23(25)24-21-18-16-19-22-24/h2-22H2,1H3 |
InChIKey | MFZHIRGDMBVSTF-UHFFFAOYSA-N |