For research use only. Not for therapeutic Use.
1-(propan-2-yl)-1H-pyrazole-3-sulfonamide(Cat No.:L007753). This chemical is a sulfonamide derivative, a class of compounds known for their diverse biological activities. Sulfonamides have been used as antibacterial agents and serve as structural components in various pharmaceuticals. In the case of 1-(propan-2-yl)-1H-pyrazole-3-sulfonamide, its specific applications and properties would depend on the context of its use, such as in medicinal chemistry, agrochemicals, or materials science, where sulfonamide derivatives find applications due to their versatile chemical reactivity and biological interactions.
CAS Number | 1696838-10-4 |
Molecular Formula | C6H11N3O2S |
Purity | ≥95% |
IUPAC Name | 1-propan-2-ylpyrazole-3-sulfonamide |
InChI | InChI=1S/C6H11N3O2S/c1-5(2)9-4-3-6(8-9)12(7,10)11/h3-5H,1-2H3,(H2,7,10,11) |
InChIKey | GHNBPPOAWRAEJT-UHFFFAOYSA-N |
SMILES | CC(C)N1C=CC(=N1)S(=O)(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |