For research use only. Not for therapeutic Use.
1-Propylpyrimidine-2,4(1H,3H)-dione(Cat No.:L007480), is a chemical compound with potential applications in various scientific and industrial fields. It is a pyrimidine derivative, containing a pyrimidine ring, a six-membered heterocyclic structure with two nitrogen atoms. This compound’s specific structure and properties make it interesting for research and development purposes, including its potential in pharmaceuticals, agrochemicals, and material science.
Catalog Number | L007480 |
CAS Number | 24466-52-2 |
Molecular Formula | C7H10N2O2 |
Purity | ≥95% |
IUPAC Name | 1-propylpyrimidine-2,4-dione |
InChI | InChI=1S/C7H10N2O2/c1-2-4-9-5-3-6(10)8-7(9)11/h3,5H,2,4H2,1H3,(H,8,10,11) |
InChIKey | DVLXMSGVTVOEGA-UHFFFAOYSA-N |
SMILES | CCCN1C=CC(=O)NC1=O |