For research use only. Not for therapeutic Use.
1-Pyrenebutylamine(Cat No.:R000387) is a compound consisting of a pyrene moiety attached to a butylamine group. It is commonly used as a fluorescent probe in biochemical and analytical chemistry applications. The pyrene moiety imparts strong fluorescence properties to the molecule, making it useful for studying various biological processes, such as protein folding, lipid membrane dynamics, and DNA interactions. Additionally, 1-pyrenebutylamine has been employed as a molecular sensor for detecting environmental pollutants and as a labeling agent for biomolecules in fluorescence-based assays.
CAS Number | 205488-15-9 |
Synonyms | 1-Pyrenebutanamine; 1-(4-Aminobutyl)pyrene; 4-(1-Pyrenyl)butylamine |
Molecular Formula | C20H19N |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 4-pyren-1-ylbutan-1-amine |
InChI | InChI=1S/C20H19N/c21-13-2-1-4-14-7-8-17-10-9-15-5-3-6-16-11-12-18(14)20(17)19(15)16/h3,5-12H,1-2,4,13,21H2 |
InChIKey | BKRIEFUMDWSFKX-UHFFFAOYSA-N |
SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCCN |