For research use only. Not for therapeutic Use.
1-(Pyridin-2-yl)propan-2-one(Cat No.:L019246)is an important organic compound used as a versatile intermediate in chemical synthesis, particularly in the pharmaceutical and agrochemical industries. This compound features a pyridine ring attached to a propan-2-one (acetone) moiety, making it a valuable building block for the development of various bioactive molecules. Its structure allows for easy modifications, facilitating the synthesis of a wide range of compounds, including enzyme inhibitors and other therapeutic agents. Its role in medicinal chemistry makes it essential in drug discovery and development efforts.
CAS Number | 6302-02-9 |
Molecular Formula | C8H9NO |
Purity | ≥95% |
IUPAC Name | 1-pyridin-2-ylpropan-2-one |
InChI | InChI=1S/C8H9NO/c1-7(10)6-8-4-2-3-5-9-8/h2-5H,6H2,1H3 |
InChIKey | TZTXTIBZSSSFDI-UHFFFAOYSA-N |
SMILES | CC(=O)CC1=CC=CC=N1 |