Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
1-(pyridin-3-yl)-1H-pyrazole-4-carbaldehyde
For research use only. Not for therapeutic Use.
1-(Pyridin-3-yl)-1H-pyrazole-4-carbaldehyde is an organic compound featuring a pyrazole ring substituted with a pyridine moiety at the 1-position and an aldehyde group at the 4-position. This unique structure enhances its reactivity and potential applications in medicinal chemistry. The aldehyde functional group can engage in various chemical transformations, including condensation and nucleophilic addition reactions. This compound may serve as a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other bioactive molecules, particularly those targeting specific biological pathways.
Catalog Number | L032316 |
CAS Number | 1098004-79-5 |
Molecular Formula | C9H7N3O |
Purity | ≥95% |
IUPAC Name | 1-pyridin-3-ylpyrazole-4-carbaldehyde |
InChI | InChI=1S/C9H7N3O/c13-7-8-4-11-12(6-8)9-2-1-3-10-5-9/h1-7H |
InChIKey | WFVPWRGLCLBLNE-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)N2C=C(C=N2)C=O |