For research use only. Not for therapeutic Use.
1-(Pyridin-4-ylmethyl)-1H-pyrazol-4-amine(Cat No.:L007555), is a chemical compound featuring a pyrazole ring with an amino group at the 4th position and a pyridin-4-ylmethyl group attached to the 1st position. This compound is vital in organic synthesis and medicinal chemistry, serving as a key scaffold in drug discovery research. Its unique structure suggests potential pharmacological activities, making it valuable for further exploration in pharmaceutical research.
Catalog Number | L007555 |
CAS Number | 1152841-31-0 |
Molecular Formula | C9H10N4 |
Purity | ≥95% |
Storage | 2–8 °C |
IUPAC Name | 1-(pyridin-4-ylmethyl)pyrazol-4-amine |
InChI | InChI=1S/C9H10N4/c10-9-5-12-13(7-9)6-8-1-3-11-4-2-8/h1-5,7H,6,10H2 |
InChIKey | CJIHPWPQPCVINA-UHFFFAOYSA-N |
SMILES | C1=CN=CC=C1CN2C=C(C=N2)N |