Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-(pyridin-4-ylmethyl)-1H-pyrrole-2-carboxylic acid
For research use only. Not for therapeutic Use.
1-(Pyridin-4-ylmethyl)-1H-pyrrole-2-carboxylic acid(Cat No.:L007570), is a chemical compound consisting of a pyrrole ring with a carboxylic acid group at the 2-position and a pyridin-4-ylmethyl group attached to the nitrogen atom. This unique molecular structure has applications in medicinal chemistry and drug discovery. Researchers investigate its interactions with biological targets, exploring its potential therapeutic properties. Compounds like this often serve as intermediates in pharmaceutical research, enabling the synthesis of diverse molecules for biological testing.
CAS Number | 896049-21-1 |
Molecular Formula | C11H10N2O2 |
Purity | ≥95% |
IUPAC Name | 1-(pyridin-4-ylmethyl)pyrrole-2-carboxylic acid |
InChI | InChI=1S/C11H10N2O2/c14-11(15)10-2-1-7-13(10)8-9-3-5-12-6-4-9/h1-7H,8H2,(H,14,15) |
InChIKey | KCVWZQCSHAEPIG-UHFFFAOYSA-N |
SMILES | C1=CN(C(=C1)C(=O)O)CC2=CC=NC=C2 |