Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 1-Pyridin-4-ylpiperidin-4-one
For research use only. Not for therapeutic Use.
1-Pyridin-4-ylpiperidin-4-one (Cat.No:L042318) is a chemical intermediate used in the synthesis of diverse organic compounds. Its pyridine and piperidinone moieties provide structural versatility, making it valuable for creating complex molecules in pharmaceutical and chemical research. This compound plays a crucial role in designing and developing various functional materials.
CAS Number | 126832-81-3 |
Molecular Formula | C10H12N2O |
Purity | ≥95% |
IUPAC Name | 1-pyridin-4-ylpiperidin-4-one |
InChI | InChI=1S/C10H12N2O/c13-10-3-7-12(8-4-10)9-1-5-11-6-2-9/h1-2,5-6H,3-4,7-8H2 |
InChIKey | MAXMUBIIZUKOJF-UHFFFAOYSA-N |