For research use only. Not for therapeutic Use.
1-Pyrrolidino-1-cyclohexene (Cat No.:R043922) is a chemical compound. It consists of a cyclohexene ring linked to a pyrrolidine ring. This compound is utilized in organic synthesis as a building block to create more complex molecules. Its unique structure imparts reactivity that enables the formation of diverse chemical bonds. As a versatile intermediate, it serves as a key component in the preparation of various compounds with specific functionalities. Its role in chemical transformations contributes to its significance in producing complex molecules for pharmaceuticals, agrochemicals, and materials science research.
Catalog Number | R043922 |
CAS Number | 1125-99-1 |
Synonyms | 1-(1-Cyclohexen-1-yl)pyrrolidine; 1-(1-Cyclohexenyl)pyrrolidine; 1-(1-Pyrrolidino)-1-cyclohexene; 1-(1-Pyrrolidinyl)cyclohexene; 1-(Pyrrolidine-1-yl)-1-cyclohexene; 1-Pyrrolidinocyclohexene; Cyclohexanone Pyrrolidine Enamine; N-(1-Cyclohexen-1-yl)pyr |
Molecular Formula | C10H17N |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1-(cyclohexen-1-yl)pyrrolidine |
InChI | InChI=1S/C10H17N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h6H,1-5,7-9H2 |
InChIKey | KTZNVZJECQAMBV-UHFFFAOYSA-N |
SMILES | C1CCC(=CC1)N2CCCC2 |