Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 1-(tert-Butoxycarbonyl)-4-hydroxypiperidine-4-carboxylic acid
For research use only. Not for therapeutic Use.
1-(tert-Butoxycarbonyl)-4-hydroxypiperidine-4-carboxylic acid(Cat No.:L019960), is a piperidine derivative with a tert-butoxycarbonyl (Boc) protecting group on the nitrogen atom and a hydroxyl group at the 4-position of the piperidine ring. The carboxylic acid group is also attached to the 4-position. This compound is used in organic synthesis and pharmaceutical research as a building block to introduce specific functionalities into target molecules. Its controlled reactivity makes it valuable in drug development and medicinal chemistry research.
CAS Number | 495414-64-7 |
Molecular Formula | C11H19NO5 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
InChI | InChI=1S/C11H19NO5/c1-10(2,3)17-9(15)12-6-4-11(16,5-7-12)8(13)14/h16H,4-7H2,1-3H3,(H,13,14) |
InChIKey | BLWCMYNTGFJVOC-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |