For research use only. Not for therapeutic Use.
1-Thioglycerol is a high-purity compound used in biochemical research and organic synthesis. This thiol-containing molecule is essential for studying redox reactions, protein thiolation, and as a stabilizer in various biochemical assays. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced chemical synthesis and molecular biology applications. Ideal for experimental setups, 1-Thioglycerol enhances research accuracy and efficiency.
Catalog Number | R023843 |
CAS Number | 96-27-5 |
Synonyms | 3-Mercapto-1,2-propanediol; (±)-3-Mercapto-1,2-propanediol; 1,2-Dihydroxy-3-mercaptopropane; 1-Mercapto-2,3-dihydroxypropane; 1-Mercapto-2,3-propanediol; 1-Mercaptoglycerol; 1-Monothioglycerol; 1-Thio-2,3-propanediol; 1-Thio-DL-glycerol; 2,3-Dihydrox |
Molecular Formula | C3H8O2S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-sulfanylpropane-1,2-diol |
InChI | InChI=1S/C3H8O2S/c4-1-3(5)2-6/h3-6H,1-2H2 |
InChIKey | PJUIMOJAAPLTRJ-UHFFFAOYSA-N |
SMILES | C(C(CS)O)O |