For research use only. Not for therapeutic Use.
(1-Tosyl-1H-indol-4-yl)methanamine(Cat No.:L025006)is an indole derivative featuring a tosyl group at the 1-position and a methanamine group at the 4-position. This compound is widely used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and bioactive molecules. The tosyl group enhances the compound’s reactivity, allowing for targeted modifications and complex molecule construction. With its unique structure and high purity, (1-Tosyl-1H-indol-4-yl)methanamine is essential for advanced research in medicinal chemistry and drug development, facilitating precise and efficient chemical transformations.
CAS Number | 1145678-74-5 |
Molecular Formula | C16H16N2O2S |
Purity | ≥95% |
IUPAC Name | [1-(4-methylphenyl)sulfonylindol-4-yl]methanamine |
InChI | InChI=1S/C16H16N2O2S/c1-12-5-7-14(8-6-12)21(19,20)18-10-9-15-13(11-17)3-2-4-16(15)18/h2-10H,11,17H2,1H3 |
InChIKey | JHRFJDRMDHBZPF-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(C=CC=C32)CN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |