For research use only. Not for therapeutic Use.
1-trans-2-cis-4-Trimethylcyclopentane is a cycloalkane compound used in chemical synthesis and materials science. Its unique structure makes it valuable for studying stereoisomerism and conformational analysis in organic chemistry. This compound is essential for developing new materials and understanding complex chemical reactions. Researchers utilize 1-trans-2-cis-4-Trimethylcyclopentane to achieve precise and reliable results in advanced scientific investigations, contributing significantly to innovations in synthetic methodologies, polymer science, and industrial applications.
Catalog Number | R014603 |
CAS Number | 16883-48-0 |
Synonyms | (1α,2β,4α)-1,2,4-Trimethyl-cyclopentane; 1-trans-2-cis-4-Trimethylcyclopentane; trans-1,2,cis-1,4-1,2,4-Trimethyl-cyclopentane; trans,cis-1,2,4-Trimethylcyclopentane |
Molecular Formula | C8H16 |
Purity | ≥95% |
Storage | Desiccate at -20 ℃ |
IUPAC Name | (1R,2R)-1,2,4-trimethylcyclopentane |
InChI | InChI=1S/C8H16/c1-6-4-7(2)8(3)5-6/h6-8H,4-5H2,1-3H3/t7-,8-/m1/s1 |
InChIKey | PNUFYSGVPVMNRN-HTQZYQBOSA-N |
SMILES | CC1CC(C(C1)C)C |