For research use only. Not for therapeutic Use.
10-Formyl folic acid(Cat No.:R051861), is a derivative of folic acid, a B vitamin essential for various biological processes. This compound features a formyl group (-CHO) attached at the 10th position of the folic acid molecule. Such modifications can impact the compound’s interactions with enzymes and receptors involved in cellular metabolism and DNA synthesis. Understanding these modifications can provide insights into the structure-activity relationships of folic acid derivatives and their potential applications in pharmaceuticals or nutritional supplements.
CAS Number | 134-05-4 |
Synonyms | N-[4-[[(2-Amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]formylamino]benzoyl]-L-glutamic Acid; 10-Formylpteroylglutamic Acid; N10-Formylfolic Acid; N-[p-[N-[(2-Amino-4-hydroxy-6-pteridinyl)methyl]formamido]benzoyl]-glutamic Acid; |
Molecular Formula | C20H19N7O7 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20°C |
IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-1H-pteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanedioic acid |
InChI | InChI=1S/C20H19N7O7/c21-20-25-16-15(18(32)26-20)23-11(7-22-16)8-27(9-28)12-3-1-10(2-4-12)17(31)24-13(19(33)34)5-6-14(29)30/h1-4,7,9,13H,5-6,8H2,(H,24,31)(H,29,30)(H,33,34)(H3,21,22,25,26,32)/t13-/m0/s1 |
InChIKey | UGWUWNVTCLDEOG-ZDUSSCGKSA-N |
SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)N(CC2=CN=C3C(=N2)C(=O)N=C(N3)N)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |