For research use only. Not for therapeutic Use.
10-Oxo-trans-8-decenoic acid is an organic compound with a keto group at the tenth position and a double bond in the trans configuration at the eighth position. It is of interest in biochemical research and synthetic chemistry for its unique structural properties. This compound is studied for its potential applications in developing new materials, pharmaceuticals, and understanding metabolic pathways.
| Catalog Number | R028252 |
| CAS Number | 69152-89-2 |
| Molecular Formula | C10H16O3 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | 10-oxodec-8-enoic acid |
| InChI | InChI=1S/C10H16O3/c11-9-7-5-3-1-2-4-6-8-10(12)13/h5,7,9H,1-4,6,8H2,(H,12,13) |
| InChIKey | YUAQBOMIASXPQW-UHFFFAOYSA-N |
| SMILES | C(CCCC(=O)O)CCC=CC=O |
