For research use only. Not for therapeutic Use.
10058-F4(Cat No.:I003466) is a potent inhibitor of the c-Myc-Max interaction, effectively preventing the transcriptional activation of c-Myc target genes. By inhibiting c-Myc activity, 10058-F4 hampers cell proliferation and promotes apoptosis through the activation of Caspase-3. Additionally, it plays a role in regulating autophagy, the cellular process of self-degradation. Through its multifaceted actions, 10058-F4 exhibits potential therapeutic applications in diseases where c-Myc signaling is dysregulated, such as cancer, by targeting key pathways involved in cell survival and growth.
CAS Number | 403811-55-2 |
Synonyms | (5E)-5-[(4-ethylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
Molecular Formula | C₁₂H₁₁NOS₂ |
Purity | ≥95% |
Target | Autophagy |
Solubility | DMSO: ≥ 41 mg/mL |
Storage | 2-8°C |
IUPAC Name | (5E)-5-[(4-ethylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
InChI | InChI=1S/C12H11NOS2/c1-2-8-3-5-9(6-4-8)7-10-11(14)13-12(15)16-10/h3-7H,2H2,1H3,(H,13,14,15)/b10-7+ |
InChIKey | SVXDHPADAXBMFB-JXMROGBWSA-N |
SMILES | CCC1=CC=C(C=C1)C=C2C(=O)NC(=S)S2 |