10074-A4 (Cat No.:I008422) is a small molecule inhibitor that disrupts the interaction between the transcription factor c-Myc and Max protein. It selectively inhibits c-Myc-mediated gene expression and has shown promise in suppressing tumor growth in preclinical studies. By targeting the oncogenic function of c-Myc, 10074-A4 holds potential for cancer research and therapy. It offers a means to interfere with the aberrant signaling pathways associated with c-Myc, making it a valuable tool in understanding and potentially treating c-Myc-driven cancers.
| Catalog Number | I008422 |
| CAS Number | 312631-87-1 |
| Synonyms | 10074-A4; 10074 A4; 10074A4; |
| Molecular Formula | C18H14Cl2N2O3S |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Store at -20°C |
| IUPAC Name | 3-[3-(3,6-Dichloro-carbazol-9-yl)-2-hydroxy-propyl]-thiazolidine-2,4-dione |
| InChI | InChI=1S/C18H14Cl2N2O3S/c19-10-1-3-15-13(5-10)14-6-11(20)2-4-16(14)21(15)7-12(23)8-22-17(24)9-26-18(22)25/h1-6,12,23H,7-9H2 |
| InChIKey | SCNHANGMZXFWOH-UHFFFAOYSA-N |
| SMILES | O=C(N1CC(O)CN2C3=C(C4=C2C=CC(Cl)=C4)C=C(Cl)C=C3)SCC1=O |
| Reference | 1: Jin F, Yu C, Lai L, Liu Z. Ligand clouds around protein clouds: a scenario of ligand binding with intrinsically disordered proteins. PLoS Comput Biol. 2013;9(10):e1003249. doi: 10.1371/journal.pcbi.1003249. Epub 2013 Oct 3. PubMed PMID: 24098099; PubMed Central PMCID: PMC3789766. |
