For research use only. Not for therapeutic Use.
10,10′-Dibromo-9,9′-bianthryl(Cat No.:M028553) is a brominated biphenyl derivative consisting of two anthracene units linked at the 9 and 9′ positions, with bromine atoms attached at the 10 and 10′ positions. This compound is notable for its polycyclic aromatic structure, which includes extended π-conjugation, enhancing its optical properties. 10,10′-Dibromo-9,9′-bianthryl is primarily used in organic electronics and photonics due to its ability to emit fluorescence and act as an electron acceptor. Its application includes organic light-emitting diodes (OLEDs) and other optoelectronic devices, which contribute to light absorption and emission processes.
CAS Number | 121848-75-7 |
Molecular Formula | C28H16Br2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 9-bromo-10-(10-bromoanthracen-9-yl)anthracene |
InChI | InChI=1S/C28H16Br2/c29-27-21-13-5-1-9-17(21)25(18-10-2-6-14-22(18)27)26-19-11-3-7-15-23(19)28(30)24-16-8-4-12-20(24)26/h1-16H |
InChIKey | NPNNLGXEAGTSRN-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2Br)C4=C5C=CC=CC5=C(C6=CC=CC=C64)Br |