For research use only. Not for therapeutic Use.
Iminodibenzyl(Cat No.:R058134) is a versatile chemical compound widely employed as a catalyst and reducing agent in organic synthesis. Its primary function is as a hydrogenating and reducing agent in reactions catalyzed by transition metals, particularly in the hydrogenation of carbonyl compounds and unsaturated compounds. Additionally, iminodibenzyl finds applications in electrochemical synthesis, electrochemical catalysis, and fuel cell research. It serves as a valuable tool in various fields, facilitating diverse organic transformations and contributing to advancements in chemical and electrochemical processes.
CAS Number | 494-19-9 |
Synonyms | 10,11-Dihydrodibenz[b,f]azepine; 2,2’-Iminobibenzyl; 2,2’-Iminodibenzyl; Iminobibenzyl; Iminodibenzyl; NSC 72110; |
Molecular Formula | C14H13N |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 6,11-dihydro-5H-benzo[b][1]benzazepine |
InChI | InChI=1S/C14H13N/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)15-13/h1-8,15H,9-10H2 |
InChIKey | ZSMRRZONCYIFNB-UHFFFAOYSA-N |
SMILES | C1CC2=CC=CC=C2NC3=CC=CC=C31 |