10,11-Methylenedioxycamptothecin（Cat No.:M138297）, also known as methylenedioxy-camptothecin (MDC), is a derivative of camptothecin, a naturally occurring alkaloid found in the bark and stem of the Camptotheca acuminata tree. MDC is a potent antitumor agent with a mechanism of action similar to camptothecin, inhibiting topoisomerase I and inducing DNA damage in cancer cells. However, MDC exhibits improved solubility and stability compared to camptothecin, making it a promising candidate for the treatment of various cancers. Research suggests that MDC may have potential therapeutic applications in cancer chemotherapy, particularly in the treatment of solid tumors.
| Catalog Number | M138297 |
| CAS Number | 135415-73-5 |
| Molecular Formula | C21H16N2O6 |
| Purity | ≥95% |
| Storage | Desiccate at -20C |
| IUPAC Name | (5S)-5-ethyl-5-hydroxy-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(13),2,4(9),14,16,21,23-heptaene-6,10-dione |
| InChI | InChI=1S/C21H16N2O6/c1-2-21(26)13-5-15-18-11(7-23(15)19(24)12(13)8-27-20(21)25)3-10-4-16-17(29-9-28-16)6-14(10)22-18/h3-6,26H,2,7-9H2,1H3/t21-/m0/s1 |
| InChIKey | RPFYDENHBPRCTN-NRFANRHFSA-N |
| SMILES | CCC1(C2=C(COC1=O)C(=O)N3CC4=C(C3=C2)N=C5C=C6C(=CC5=C4)OCO6)O |
