For research use only. Not for therapeutic Use.
1,1′-[(2-Hydroxyethyl)imino]dipropan-2-ol (Cat No.:M056128) is a chemical compound. It consists of two hydroxyethyl amine groups connected by a propane-2-ol bridge. This compound is significant in organic synthesis and chemical research due to its potential applications in various reactions. Compounds featuring hydroxyethylamine functionalities are important in the creation of pharmaceuticals and other biologically active molecules. The presence of a propane-2-ol bridge adds specific reactivity and functional diversity to the compound.
Catalog Number | M056128 |
CAS Number | 10353-86-3 |
Molecular Formula | C8H19NO3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1-[2-hydroxyethyl(2-hydroxypropyl)amino]propan-2-ol |
InChI | InChI=1S/C8H19NO3/c1-7(11)5-9(3-4-10)6-8(2)12/h7-8,10-12H,3-6H2,1-2H3 |
InChIKey | HHKUQCFQGCCLGA-UHFFFAOYSA-N |
SMILES | CC(CN(CCO)CC(C)O)O |