For research use only. Not for therapeutic Use.
11-Azido-3,6,9-trioxaundecanoic acid(Cat No.:M137862)is a specialized chemical compound. It features an undecanoic acid backbone substituted with three ether groups (trioxa) and an azido group at the 11th position. This structure imparts unique properties, making it useful in polymer chemistry and bioconjugation techniques. The azido group is particularly reactive under click chemistry conditions, allowing for efficient coupling with alkynes to form stable triazole linkages. This compound is used in the synthesis of surface coatings, drug delivery systems, and in the modification of biomolecules for medical research.
Catalog Number | M137862 |
CAS Number | 172531-37-2 |
Synonyms | 11-Azido-3,6,9-trioxaundecanoic Acid |
Molecular Formula | C8H15N3O5 |
Purity | ≥95% |
Target | PROTAC Linkers |
IUPAC Name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetic acid |
InChI | InChI=1S/C8H15N3O5/c9-11-10-1-2-14-3-4-15-5-6-16-7-8(12)13/h1-7H2,(H,12,13) |
InChIKey | GIXBCECBLAEYKA-UHFFFAOYSA-N |
SMILES | C(COCCOCCOCC(=O)O)N=[N+]=[N-] |