Home
>
Catalysts and Ligands>Chiral phosphine ligands> [1,1'-Binaphthalen]-2-yldi-tert-butylphosphine
For research use only. Not for therapeutic Use.
[1,1′-Binaphthalen]-2-yldi-tert-butylphosphine is a phosphine ligand featuring a binaphthyl backbone and two bulky tert-butyl groups attached to a phosphorus atom. This compound is widely used in organometallic chemistry and catalysis, particularly in asymmetric synthesis and cross-coupling reactions like Suzuki-Miyaura coupling. The steric hindrance provided by the tert-butyl groups and the rigid binaphthyl structure enhance its selectivity and stability in catalytic processes. It is valuable in the development of enantioselective reactions and fine chemical synthesis.
CAS Number | 255836-67-0 |
Molecular Formula | C28H31P |
Purity | ≥95% |
IUPAC Name | ditert-butyl-(1-naphthalen-1-ylnaphthalen-2-yl)phosphane |
InChI | InChI=1S/C28H31P/c1-27(2,3)29(28(4,5)6)25-19-18-21-13-8-10-16-23(21)26(25)24-17-11-14-20-12-7-9-15-22(20)24/h7-19H,1-6H3 |
InChIKey | QGBQGMHXBSLYLZ-UHFFFAOYSA-N |
SMILES | CC(C)(C)P(C1=C(C2=CC=CC=C2C=C1)C3=CC=CC4=CC=CC=C43)C(C)(C)C |