For research use only. Not for therapeutic Use.
1,1′-Bis(4-aminophenyl)-[4,4′-bipyridine]-1,1′-diium chloride (Cat.No:L003847) is a pivotal compound in materials science. Its unique molecular structure incorporates bipyridine and amino groups, imparting specialized reactivity. This compound is a crucial component in the synthesis of specialized polymers and materials, particularly in the field of organic electronics.
CAS Number | 222973-24-2 |
Molecular Formula | C22H20Cl2N4 |
Purity | ≥95% |
IUPAC Name | 4-[4-[1-(4-aminophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]aniline;dichloride |
InChI | InChI=1S/C22H19N4.2ClH/c23-19-1-5-21(6-2-19)25-13-9-17(10-14-25)18-11-15-26(16-12-18)22-7-3-20(24)4-8-22;;/h1-16,23H,24H2;2*1H/q+1;;/p-1 |
InChIKey | XSUWRTGTBGEUML-UHFFFAOYSA-M |
SMILES | C1=CC(=CC=C1N)[N+]2=CC=C(C=C2)C3=CC=[N+](C=C3)C4=CC=C(C=C4)N.[Cl-].[Cl-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |