For research use only. Not for therapeutic Use.
11-cis-Retinol(Cat No.:R050038) is a specific form of vitamin A, an essential nutrient for maintaining healthy vision, skin, and immune function. This molecule differs from other forms of vitamin A in its molecular geometry, featuring a cis configuration at the 11th double bond in its hydrocarbon chain. This configuration is crucial for its role in the visual cycle, where it combines with opsin proteins in the retina to form rhodopsin, a pigment necessary for low-light (scotopic) vision. Due to its high purity (>85%), this specific form of retinol is extensively used in biochemical and physiological research, particularly studies focusing on vision and eye health.
CAS Number | 22737-96-8 |
Synonyms | 11-cis-Retinol; 11-cis-Vitamin A Alcohol; |
Molecular Formula | C20H30O |
Purity | 85% |
Storage | Store at -20°C |
IUPAC Name | (2E,4Z,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol |
InChI | InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6-,12-11+,16-8+,17-13+ |
InChIKey | FPIPGXGPPPQFEQ-IOUUIBBYSA-N |
SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CCO)C)C |