For research use only. Not for therapeutic Use.
11-cis-vaccenyl acetate (Cat.No:M004373) is a natural compound found in the pheromones of various insect species. It plays a role in insect communication and social behavior, particularly in species like ants and bees. This compound’s chemical signaling helps regulate colony activities, making it a subject of interest in entomology and chemical ecology.
CAS Number | 6186-98-7 |
Synonyms | 11-cis Vaccenyl Acetate;(Z)-octadec-11-enyl acetate;11-cis Vaccenyl Acetate Exclusive |
Molecular Formula | C20H38O2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | [(Z)-octadec-11-enyl] acetate |
InChI | InChI=1S/C20H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h8-9H,3-7,10-19H2,1-2H3/b9-8- |
InChIKey | QSZKEDWVAOAFQY-HJWRWDBZSA-N |
SMILES | CCCCCC/C=CCCCCCCCCCCOC(=O)C |
Reference | <span style=”font-family:arial,helvetica,sans-serif;”><span style=”font-size:12px;”>1.<span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”>Ha, Tal Soo, and Dean P. Smith. "A pheromone receptor mediates 11-cis-vaccenyl acetate-induced responses in Drosophila." </span><i style=”font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;”>Journal of Neuroscience</i><span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”> 26.34 (2006): 8727-8733.<br /> |