For research use only. Not for therapeutic Use.
1,1-Cyclobutanedicarboxylic acid(Cat No.:L012260)is a dicarboxylic acid characterized by its unique cyclobutane ring, a four-membered carbon ring, making it a rigid and reactive molecule. This compound is extensively used in organic synthesis, particularly in the creation of polymers, pharmaceuticals, and specialty chemicals. Its two carboxyl groups provide points of functionalization, allowing for the formation of various derivatives with enhanced properties such as increased solubility and reactivity. 1,1-Cyclobutanedicarboxylic acid is also a key intermediate in synthesizing complex molecular architectures used in high-performance materials and drug design.
CAS Number | 5445-51-2 |
Molecular Formula | C6H8O4 |
Purity | ≥95% |
IUPAC Name | cyclobutane-1,1-dicarboxylic acid |
InChI | InChI=1S/C6H8O4/c7-4(8)6(5(9)10)2-1-3-6/h1-3H2,(H,7,8)(H,9,10) |
InChIKey | CCQPAEQGAVNNIA-UHFFFAOYSA-N |
SMILES | C1CC(C1)(C(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |