For research use only. Not for therapeutic Use.
1,1-Cyclopentanedimethanol is a cyclopentane derivative featuring two methanol groups attached to the same carbon atom, making it a diol. This unique structure provides the compound with interesting chemical properties, such as the ability to participate in hydrogen bonding and form various derivatives. Its solubility and reactivity make it valuable in organic synthesis, particularly in the preparation of polyols and other functionalized compounds. 1,1-Cyclopentanedimethanol may also find applications in pharmaceuticals, materials science, and chemical research.
CAS Number | 5763-53-1 |
Molecular Formula | C7H14O2 |
Purity | ≥95% |
IUPAC Name | [1-(hydroxymethyl)cyclopentyl]methanol |
InChI | InChI=1S/C7H14O2/c8-5-7(6-9)3-1-2-4-7/h8-9H,1-6H2 |
InChIKey | OKSKZFYXWJAIIT-UHFFFAOYSA-N |
SMILES | C1CCC(C1)(CO)CO |