For research use only. Not for therapeutic Use.
11-Dehydrocorticosterone（Cat No.:R032837）is a steroid hormone, structurally related to corticosterone, with a key modification at the 11th carbon position. This compound is primarily studied in the context of adrenal gland function and stress response pathways. As a precursor in the biosynthesis of other corticosteroids, it plays a role in regulating inflammation, metabolism, and immune responses. It is often used in research on steroidogenesis, hormone regulation, and endocrine signaling. Studies also explore its potential effects on metabolic disorders, immune system modulation, and its role in various diseases associated with adrenal dysfunction.
| CAS Number | 72-23-1 |
| Synonyms | (8S,9S,10R,13S,14S,17S)-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
| Molecular Formula | C21H28O4 |
| Purity | ≥95% |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
| InChI | InChI=1S/C21H28O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h9,14-16,19,22H,3-8,10-11H2,1-2H3/t14-,15-,16+,19+,20-,21-/m0/s1 |
| InChIKey | FUFLCEKSBBHCMO-KJQYFISQSA-N |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2C(=O)C[C@]4([C@H]3CC[C@@H]4C(=O)CO)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
