For research use only. Not for therapeutic Use.
11-Dehydroxygrevilloside B is a natural saponin compound derived from certain plant species. Saponins like 11-Dehydroxygrevilloside B are known for their surfactant properties, which enable them to form stable foam and emulsions. These compounds are studied for their potential biological activities, including anti-inflammatory, antimicrobial, and anticancer effects.
CAS Number | 197307-49-6 |
Molecular Formula | C17H26O7 |
Purity | ≥95% |
Target | Disease Research Fields |
Storage | -20°C |
IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(3-hydroxy-5-pentylphenoxy)oxane-3,4,5-triol |
InChI | InChI=1S/C17H26O7/c1-2-3-4-5-10-6-11(19)8-12(7-10)23-17-16(22)15(21)14(20)13(9-18)24-17/h6-8,13-22H,2-5,9H2,1H3/t13-,14-,15+,16-,17-/m1/s1 |
InChIKey | MWVXDTUYXNKDPO-NQNKBUKLSA-N |
SMILES | CCCCCC1=CC(=CC(=C1)OC2C(C(C(C(O2)CO)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |