For research use only. Not for therapeutic Use.
11-Deoxy fusidic acid is a derivative of fusidic acid, a steroid antibiotic known for its effectiveness against gram-positive bacteria, including methicillin-resistant Staphylococcus aureus (MRSA). This derivative lacks the hydroxyl group at the 11th position, which may affect its mechanism of action and potency. It is used in research to understand how structural changes influence antibiotic activity and to potentially develop new antibiotics with improved efficacy and reduced resistance profiles.
CAS Number | 1013937-16-0 |
Synonyms | (3α,4α,8α,9β,13α,14β,16β,17Z)-16-(Acetyloxy)-3-hydroxy-29-nordammara-17(20),24-dien-21-oic Acid; |
Molecular Formula | C31H48O5 |
Purity | ≥95% |
Documentation | |
Storage | Store at RT |
IUPAC Name | (2Z)-2-[(3R,4S,5S,8S,9S,10S,13R,14S,16R)-16-acetyloxy-3-hydroxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoic acid |
InChI | InChI=1S/C31H48O5/c1-18(2)9-8-10-21(28(34)35)27-23-11-12-26-29(5)15-14-24(33)19(3)22(29)13-16-30(26,6)31(23,7)17-25(27)36-20(4)32/h9,19,22-26,33H,8,10-17H2,1-7H3,(H,34,35)/b27-21-/t19-,22-,23-,24+,25+,26-,29-,30-,31-/m0/s1 |
InChIKey | XIQFIBYNKGFJIX-SXBPZAMBSA-N |
SMILES | CC1C2CCC3(C(C2(CCC1O)C)CCC4C3(CC(C4=C(CCC=C(C)C)C(=O)O)OC(=O)C)C)C |