For research use only. Not for therapeutic Use.
11-Deoxy Prednisolone(CAT: R046997) is a synthetic corticosteroid and a key intermediate in the production of various glucocorticoid medications. Structurally similar to prednisolone, this compound lacks the hydroxyl group at the 11th position, which affects its activity profile. It is often used in pharmaceutical research and synthesis as a precursor for other corticosteroids, particularly those involved in anti-inflammatory and immunosuppressive therapies. By modulating the immune response, 11-Deoxy Prednisolone contributes to the development of medications for conditions like asthma, autoimmune diseases, and allergic reactions. Its role in steroid biosynthesis highlights its importance in drug development processes.
CAS Number | 1807-14-3 |
Synonyms | 17,21-Dihydroxypregna-1,4-diene-3,20-dione; 17α,21-Dihydroxypregna-1,4-?diene-3,20-dione; 1,4-Reichstein S; Δ’-Dehydrocortexolone; |
Molecular Formula | C21H28O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
InChI | InChI=1S/C21H28O4/c1-19-8-5-14(23)11-13(19)3-4-15-16(19)6-9-20(2)17(15)7-10-21(20,25)18(24)12-22/h5,8,11,15-17,22,25H,3-4,6-7,9-10,12H2,1-2H3/t15-,16+,17+,19+,20+,21+/m1/s1 |
InChIKey | BVAYTJBBDODANA-OBQKJFGGSA-N |
SMILES | CC12CCC3C(C1CCC2(C(=O)CO)O)CCC4=CC(=O)C=CC34C |